Pindobind
{{Chembox | ImageFile = Pindobind.svg | ImageSize = 200px | IUPACName = 2-Bromo-N-[4-(2-{[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino}-2-propanyl)-1-methylcyclohexyl]acetamide | OtherNames = |Section1=!Identifiers |-
|
|
|-
|
|
|- | ChemSpider
|
|-
|
|
|-
|
|
|-
|
- InChI=1S/C23H34BrN3O3/c1-22(2,16-7-10-23(3,11-8-16)27-21(29)13-24)26-14-17(28)15-30-20-6-4-5-19-18(20)9-12-25-19/h4-6,9,12,16-17,25-26,28H,7-8,10-11,13-15H2,1-3H3,(H,27,29)Key: XSAGAZCYTLNCEN-UHFFFAOYSA-N
- InChI=1/C23H34BrN3O3/c1-22(2,16-7-10-23(3,11-8-16)27-21(29)13-24)26-14-17(28)15-30-20-6-4-5-19-18(20)9-12-25-19/h4-6,9,12,16-17,25-26,28H,7-8,10-11,13-15H2,1-3H3,(H,27,29)Key: XSAGAZCYTLNCEN-UHFFFAOYAL
|-
|
- BrCC(=O)NC1(C)CCC(CC1)C(NCC(O)COc2cccc3c2cc[nH]3)(C)C
|- |Section2=!Properties |-
|
| C23H34BrN3O3 |- | Molar mass | 480.447 g·mol−1 |- |Section3= }}
Pindobind is a compound developed by researchers associated with Stanford University,[1] identified as a central nervous system depressant,[2] which generated a response in animals reducing offensive actions such as chasing, while also notably reducing tendencies of the test animal to evade when stimulated to do so.[2] It acts as an irreversible beta blocker and irreversible 5-HT1A receptor antagonist.
See also
References
- Peroutka, Stephen J.; Pitha, Josef (Jul 20, 1993), Method for relieving anxiety using 5-hydroxytryptamine-1a-receptor-binding compounds, retrieved 2016-06-04
- Bell, R; Hobson, H (1993). "Effects of pindobind 5-hydroxytryptamine1A (5-HT1A), a novel and potent 5-HT1A antagonist, on social and agonistic behaviour in male albino mice". Pharmacology Biochemistry and Behavior. 46 (1): 67–72. doi:10.1016/0091-3057(93)90318-N. PMID 8255924.
β, non-selective | |
---|---|
β1-selective | |
β2-selective | |
α1- + β-selective | |
|
5-HT1 |
| ||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5-HT2 |
| ||||||||||||||||||||||||||||||||||||||
5-HT3–7 |
| ||||||||||||||||||||||||||||||||||||||
|